Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
768-90-1 |
EC NO: |
212-200-7 |
Molecular Formula: |
C10H15Br |
Molecular Weight: |
215.1301 |
Specification: |
|
InChI: |
InChI=1/C10H15Br/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2/t7-,8+,9-,10- |
Product description:
White solid.Vacuum or sweep up material and place into a suitable disposal container. Clean up spills immediately, using the appropriate protective equipment. Avoid generating dusty conditions. Provide ventilation. Do not get water inside containers. |
Synonyms: |
1-bromotricyclo(3.3.1.13,7)decane;1-Adamantyl bromide;LABOTEST-BB LT00239617;1-Bromotricyclo[3.3.1.1(3,7)]decane;RARECHEM AQ TC 1019;1-Bromotricycol[3.3.1.1.(1,7)decane;Adamantane, 1-bromo-;Adamantyl bromide;1-Bromo adamantine;1-Bromoadamamtane;1-Bromotricyclo[3.3.1.1(3.7)]decane; |
Molecular Structure: |
 |