Details for 3-Methoxybenzylbromide

3-Methoxybenzylbromide
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
874-98-6 |
| EC NO: |
|
| Molecular Formula: |
C8H9BrO |
| Molecular Weight: |
201.0605 |
| Specification: |
|
| InChI: |
InChI=1/C8H9BrO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,6H2,1H3 |
Product description:
Molecular Formula: C8 H9 Br O
Molecular Weight: 201.0590
Purity: 98% |
| Synonyms: |
1-(Brommethyl)-3-methoxybenzol;1-(Bromomethyl)-3-methoxybenzene;3-(Bromomethyl)phenyl methyl ether;benzene, 1-(bromomethyl)-3-methoxy-; |
| Molecular Structure: |
 |
if you are sourcing 3-Methoxybenzylbromide from United-Kingdom ,just feel free to inquire