Details for Methyl 2-Hydroxy-5-methylbenzoate

Methyl 2-Hydroxy-5-methylbenzoate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
22717-57-3 |
| EC NO: |
245-173-5 |
| Molecular Formula: |
C9H10O3 |
| Molecular Weight: |
166.1739 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O3/c1-6-3-4-8(10)7(5-6)9(11)12-2/h3-5,10H,1-2H3 |
| Synonyms: |
methyl 6-hydroxy-m-toluate;5-Methylsalicylic acid methyl ester;methyl 2-hydroxy-5-methylbenzoate; |
| Molecular Structure: |
 |
if you are sourcing Methyl 2-Hydroxy-5-methylbenzoate from United-Kingdom ,just feel free to inquire