Details for 2,6-Dichloropurine

2,6-Dichloropurine
| Category: |
Intermediates |
|
| CAS NO: |
5451-40-1 |
| EC NO: |
226-681-6 |
| Molecular Formula: |
C5H2Cl2N4 |
| Molecular Weight: |
189.0022 |
| Specification: |
|
| InChI: |
InChI=1/C5H2Cl2N4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11) |
Product description:
White powder.;Remove from exposure to fresh air immediately. If not breathing, give artificial respiration. If breathing is difficult, give oxygen. Get medical aid. ;
|
| Synonyms: |
2,6-dichloro-5H-purine;2,6-dichloro-7H-purine;2,6-dichloro-9H-purine; |
| Molecular Structure: |
 |
if you are sourcing 2,6-Dichloropurine from United-States ,just feel free to inquire