Details for 2-Fluoronicotinic acid methyl ester

 
2-Fluoronicotinic acid methyl ester
 
      
        | Category: | 
        Organic chemicals and Derivatives/Acid, ester and anhydride compounds | 
        
        	 | 
      
      
        | CAS NO: | 
      446-26-4   | 
      
      
        | EC NO: | 
        
         | 
      
      
        | Molecular Formula: | 
        
        C7H6FNO2 | 
      
					
					  | Molecular Weight: | 
                      155.1264 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C7H6FNO2/c1-11-7(10)5-3-2-4-9-6(5)8/h2-4H,1H3 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      3-pyridinecarboxylic acid, 2-fluoro-, methyl ester;Methyl 2-fluoronicotinate;methyl 2-fluoropyridine-3-carboxylate;methyl 2-fluoro-3-pyridinecarboxylate; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  2-Fluoronicotinic acid methyl ester from  United-States ,just feel free to inquire