Details for Aspirin

Aspirin
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
50-78-2 |
| EC NO: |
200-064-1 |
| Molecular Formula: |
C9H8O4 |
| Molecular Weight: |
180.15 |
| Specification: |
|
| InChI: |
InChI=1/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1 |
Product description:
Odorless white crystals or crystalline powder with a slightly bitter taste.Medication. |
| Synonyms: |
o-Acetylsalicylic acid 2-Acetoxybenzoic acid;2-Acetoxybenzoic acid;aspirin usp;Aspirin;Acetoxybenzoic acid;Metronidazolum;2-(acetyloxy)benzoic acid;2-(acetyloxy)benzoate;Acetyl Salicylic Acid;Acetylsalicylic Acid; |
| Molecular Structure: |
 |
if you are sourcing Aspirin from United-States ,just feel free to inquire