111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
110475-31-5Clear colorless to faint yellow liquid. |
EC NO: |
220-423-6 |
Molecular Formula: |
C11H24N2 |
Molecular Weight: |
184.3206 |
Specification: |
|
InChI: |
InChI=1/C11H22N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13/h11-12H,1-10H2/p+2 |
Product description:
Clear colorless to faint yellow liquid.Absorb spill with inert material, (e.g., dry sand or earth), then place into a chemical waste container. Clean up spills immediately, using the appropriate protective equipment. Remove all sources of ignition. Provide ventilation. Do not get water inside containers. |
Synonyms: |
N-Benzyl Piperazine;1-(phenylmethyl)-piperazine;4-benzylpiperazine;1-(Phenylmethyl)piperazine;N-Benzylpiperazine;1-benzylpiprazine;1-benzylpiperazine 2,3-dihydroxybutanedioate (1:1);1-benzylpiperazine di[(2E)-but-2-enedioate];1-(cyclohexylmethyl)piperazinediium; |
Molecular Structure: |
 |