| Category: |
Intermediates/Dyestuff intermediates |
|
| CAS NO: |
66-71-7 |
| EC NO: |
200-629-2 |
| Molecular Formula: |
C12H8N2 |
| Molecular Weight: |
180.21 |
| Specification: |
|
| InChI: |
InChI=1/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H |
Product description:
White powder.Forms a complex compound with ferrous ions which is used under the name of ferroin â as an indicator in oxidation reduction systems, e.G., Titration of ferrous salts. |
| Synonyms: |
1,10-Phenanthroline, anhydrous;1,10-Phenanthroline anhydrate;o-Phenanthroline;1,10-o-Phenanthroline;4,5-Diazaphenanthrene;β-Phenanthroline;phenanthroline;
10-Fenanthrolin;1,10-PHENANTHROLINE ANHYDROUS; |
| Molecular Structure: |
 |