Details for Isopropyl Acetate

Isopropyl Acetate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
108-21-4 |
| EC NO: |
203-561-1 |
| Molecular Formula: |
C5H10O2 |
| Molecular Weight: |
102.1317 |
| Specification: |
|
| InChI: |
InChI=1/C5H10O2/c1-4(2)7-5(3)6/h4H,1-3H3 |
Product description:
Isopropyl acetate CAS: 108-21-4 Formula: C5H10O2 Acetic acid, isopropyl ester sec-Propyl acetate 1-Methylethyl acetate 2-Propyl acetate 2-Acetoxypropane Propan-2-yl acetate PubChem: 7915 EC (EINECS/ELINCS): 203-561-1 EC Index Number: 607-024-00-6 RTECS: AI4930000 UN: 1220 |
| Synonyms: |
Acetic acid isopropyl ester;ISO-PROPYLE ACETATE;Iso-Propyl Acetate; 2-Acetoxypropane;propan-2-yl acetate;IPAC; |
| Molecular Structure: |
 |
if you are sourcing Isopropyl Acetate from United-States ,just feel free to inquire