Details for 2-Methylpropene

2-Methylpropene
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
115-11-7 |
| EC NO: |
204-066-3 |
| Molecular Formula: |
C4H8 |
| Molecular Weight: |
56.11 |
| Specification: |
|
| InChI: |
InChI=1/C4H8/c1-4(2)3/h1H2,2-3H3 |
Product description:
Isobutylene CAS: 115-11-7 Formula: C4H8 2-Methylpropene Isobutene 2-Methylprop-1-ene PubChem: 8255 EC (EINECS/ELINCS): 204-066-3 EC Index Number: 601-012-00-4 RTECS: UD0890000 UN: 1055 Merck: 12,5155 Beilstein/Gmelin: 773645 Beilstein Reference: 4-01-00-00796 Swiss Giftliste 1: G-6787 |
| Synonyms: |
2-methylpropene;Isobutylene; |
| Molecular Structure: |
 |
if you are sourcing 2-Methylpropene from United-States ,just feel free to inquire