Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
99-04-7 |
EC NO: |
202-723-9 |
Molecular Formula: |
C8H8O2 |
Molecular Weight: |
135.1405 |
Specification: |
|
InChI: |
InChI=1/C8H8O2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
Product description:
White to yellowish crystals or mostly yellow flaky solid (with some white flakes). Has a floral-honey odor.Precursor to deet (n,n diethyl-m-toluamide) the well-known insect repellent. |
Synonyms: |
m-Methylbenzoate;m-methylbenzoic acid;m-toluylic acid;beta-methylbenzoic acid;3-methylbenzoate;3-Toluic acid;3-Methylbenzoic acid;METHYLBENZOIC(M-) ACID;RARECHEM AL BO 0048; |
Molecular Structure: |
 |