Details for 2-Hydroxyethyl Methacrylate

2-Hydroxyethyl Methacrylate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
868-77-9 |
| EC NO: |
212-782-2 |
| Molecular Formula: |
C6H10O3 |
| Molecular Weight: |
130.1418 |
| Specification: |
|
| InChI: |
InChI=1/C6H10O3/c1-4(2)6(8)9-5(3)7/h5,7H,1H2,2-3H3 |
| Synonyms: |
Glycol methacrylate;2-Hydroxyethyl methycrylate;Ethylene glycol monomethacrylate;Methacrylic acid 2-hydroxyethyl ester;2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester;beta-Hydroxyethyl Methacrylate;BISOMER HEMA;Ethylene glycol methacrylate;heme-a;Mhoromer;N-ACETYL-S-(2-HYDROXYETHYL)-L-CYSTEINE;S-(2-Hydroxyethyl)mercapturic Acid;R-(2-Hydroxyethyl)mercapturic Acid;HEMA;1-hydroxyethyl 2-methylprop-2-enoate;2-Hydroxyethylmethacrylate;Hydroxyethyl methacrylate;2-Hydroxyethy Methacrylate; |
| Molecular Structure: |
 |
if you are sourcing 2-Hydroxyethyl Methacrylate from United-States ,just feel free to inquire