Details for Ceraphyl

Ceraphyl
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
35274-05-6 |
| EC NO: |
252-478-7 |
| Molecular Formula: |
C19H38O3 |
| Molecular Weight: |
314.5032 |
| Specification: |
|
| InChI: |
InChI=1/C19H38O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19(21)18(2)20/h18,20H,3-17H2,1-2H3 |
| Synonyms: |
1-Hexadecanol Lactate;2-Hydroxypropanoic acid hexadecyl ester;2-Hydroxypropionic acid hexadecyl ester;35274-05-6;cetyl lactate;Hexadecyl 2-hydroxypropanoate;Lactic Acid Cetyl Ester;Lactic acid hexadecyl ester; |
| Molecular Structure: |
 |
if you are sourcing Ceraphyl from United-States ,just feel free to inquire