Details for Diphenyl Phosphinous Chloride

Diphenyl Phosphinous Chloride
| Category: |
Intermediates |
|
| CAS NO: |
1079-66-9 |
| EC NO: |
214-093-2 |
| Molecular Formula: |
C12H10ClP |
| Molecular Weight: |
220.6381 |
| Specification: |
|
| InChI: |
InChI:1S/C12H10ClP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
Product description:
Some uses reported in literature:
Manufacture of ligands for metal recovery.
Research intermediate.Clear light yellow to yellow liquid. |
| Synonyms: |
Diphenyl chlorophosphine;Diphenylphosphinous Chloride;Diphenylchlorophosphine;diphenylphosphine Chloride;diphenylphosphonium chloride;DPC;Aurora Ka-1322;Chlorodiphenylphospine;Diphenylphosphinchlorid;P-Chlorodiphenylphosphine;Phosphine, Chlorodiphenyl-;Diphenyl phosphine chloride; |
| Molecular Structure: |
 |
if you are sourcing Diphenyl Phosphinous Chloride from United-States ,just feel free to inquire