Details for (S)-1,2-Propanediol

(S)-1,2-Propanediol
| Category: |
Intermediates |
|
| CAS NO: |
4254-15-3 |
| EC NO: |
|
| Molecular Formula: |
C6H12O3 |
| Molecular Weight: |
132.16 |
| Specification: |
|
| InChI: |
InChI=1/C6H12O3/c1-5-3-8-4-6(2-7)9-5/h5-7H,2-4H2,1H3/t5?,6-/m0/s1 |
Product description:
Molecular Formula: C3H8O2
Molecular Weight: 76.09
Apperance: Colorless liquid
Purity: ≥98.5%
Application: 1.Intermediates of pharmaceuticals.
2.Intermediates of chiral fine chemical. |
| Synonyms: |
(S)-(+)-1,2-propanediol; |
| Molecular Structure: |
 |
if you are sourcing (S)-1,2-Propanediol from United-States ,just feel free to inquire