| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
989-51-5 |
| EC NO: |
283-519-7 |
| Molecular Formula: |
C22H18O11 |
| Molecular Weight: |
458.3717 |
| Specification: |
|
| InChI: |
InChI=1/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1 |
Product description:
Solid. The most abundant catechin in tea.An antioxidant that helps protect the skin from uv radiation-induced damage and tumor formation. |
| Synonyms: |
EGCG;(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate;Green Tea Extract Powder;;Green Tea;Green Tea P.E;Green Tea Extract;Green tea extract Polyphenols;Green tee extract;Tea Polyphenols;Tea polyphenol;Tea Polyphenol (TP98);Epigallocatechin gallate; |
| Molecular Structure: |
 |