Details for Ethyl Pyruvate

Ethyl Pyruvate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
617-35-6 |
| EC NO: |
210-511-2 |
| Molecular Formula: |
C5H8O3 |
| Molecular Weight: |
116.1152 |
| Specification: |
|
| InChI: |
InChI=1/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3 |
Product description:
Clear slightly yellow. |
| Synonyms: |
Ethyl 2-oxopropionate;Ethyl pyruvate,(Pyruvic acid ethyl ester);Pyruvic acid ethyl ester;Brenztraubensaeure-ethylester;ethyl 2-oxopropanoate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl Pyruvate from United-States ,just feel free to inquire