Details for 2-Ethyl Hexanol

2-Ethyl Hexanol
| Category: |
Other Chemicals/Others |
|
| CAS NO: |
104-76-7 |
| EC NO: |
203-234-3;248-133-5 |
| Molecular Formula: |
C8H18O |
| Molecular Weight: |
130.2279 |
| Specification: |
|
| InChI: |
InChI=1/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| Synonyms: |
2-Ethylhexan-1-ol;2-Ethylhexanol;2-ethyl hexanol;octan-3-ol;titanium(4+) tetrakis(2-ethylhexan-1-olate);(2R)-2-ethylhexan-1-ol;(2S)-2-ethylhexan-1-ol;Isooctyl Alcohol;2-EH;ISOOCTYL ALCOHOL;
|
| Molecular Structure: |
 |
if you are sourcing 2-Ethyl Hexanol from United-States ,just feel free to inquire