Details for 3-Furanboronic Acid

3-Furanboronic Acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
55552-70-0 |
| EC NO: |
|
| Molecular Formula: |
C4H5BO3 |
| Molecular Weight: |
111.8917 |
| Specification: |
|
| InChI: |
InChI=1/C4H5BO3/c6-5(7)4-1-2-8-3-4/h1-3,6-7H |
| Synonyms: |
3-Furanyl-Boronic acid;3-Furylboronic acid (contains varying amounts of anhydride);3-Furylboronic acid;3-Furanboronic acid;furan-3-ylboronic acid;Furan-3-Yl-Boranediol; |
| Molecular Structure: |
 |
if you are sourcing 3-Furanboronic Acid from United-States ,just feel free to inquire