Details for Benzoin Methyl Ether

Benzoin Methyl Ether
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
3524-62-7 |
| EC NO: |
222-538-7 |
| Molecular Formula: |
C16H18O3 |
| Molecular Weight: |
258.3123 |
| Specification: |
|
| InChI: |
InChI=1/C14H12O2.C2H6O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-2/h1-10,13,15H;1-2H3 |
| Synonyms: |
2-Methoxy-1,2-diphenylethanone;2-Methoxy-2-phenylacetophenone;alpha-Methoxy-alpha-phenylacetophenone;(2S)-2-methoxy-1,2-diphenylethanone;(2R)-2-methoxy-1,2-diphenylethanone;2-hydroxy-1,2-diphenylethanone - methoxymethane (1:1); |
| Molecular Structure: |
 |
if you are sourcing Benzoin Methyl Ether from United-States ,just feel free to inquire