Details for Phenylethyl isothiocyanate

Phenylethyl isothiocyanate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
2257-09-2 |
| EC NO: |
218-855-5 |
| Molecular Formula: |
C9H9NS |
| Molecular Weight: |
163.2395 |
| Specification: |
|
| InChI: |
InChI=1/C9H9NS/c1-8(10-7-11)9-5-3-2-4-6-9/h2-6,8H,1H3 |
| Synonyms: |
Isothiocyanic Acid Beta-Phenylethyl Ester;Beta-Phenethyl Isothiocyanate;B-Phenylethyl Isothiocyanate;2-Isothiocyanatoethylbenzene;2-Phenethyl Isothiocyanate;1-(2-Isothiocyanatoethyl)Benzene;AKOS B016323;Phenylethyl isothiocyanate;(1-isothiocyanatoethyl)benzene;Phenethyl isothiocyanate; |
| Molecular Structure: |
 |
if you are sourcing Phenylethyl isothiocyanate from United-States ,just feel free to inquire