Details for 1-Adamantyl Methyl Ketone

1-Adamantyl Methyl Ketone
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1660-04-4 |
EC NO: |
216-761-9 |
Molecular Formula: |
C12H18O |
Molecular Weight: |
178.2707 |
Specification: |
|
InChI: |
InChI=1/C12H18O/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h9-11H,2-7H2,1H3 |
Synonyms: |
1-Acetyladamantane =1-Adamantane Carboxylic acid;methyl tricyclo(3.3.1.13,7)dec-1-yl ketone;N-Benzyl-3-carboethoxy-4-piperidone hydrochloride;1-Adamantane Methyl Ketone;1-Acetyladamantane;1-(1-Adamantyl)ethan-1-one;1-(tricyclo[3.3.1.1~3,7~]dec-1-yl)ethanone;1-Acetyl Adamantane; |
Molecular Structure: |
 |
if you are sourcing 1-Adamantyl Methyl Ketone from United-States ,just feel free to inquire