Details for 2-Hydroxy-6-nitrotoluene

2-Hydroxy-6-nitrotoluene
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
5460-31-1 |
| EC NO: |
226-739-0 |
| Molecular Formula: |
C7H7NO3 |
| Molecular Weight: |
153.1354 |
| Specification: |
|
| InChI: |
InChI=1/C7H7NO3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3 |
| Synonyms: |
3-Nitro-o-cresol;2-Hydroxy-6-nitrotoluene~3-Nitro-o-cresol;2-Hydroxy-6-nitrotoluene;3-Nitro-o-cresol (2-Hydroxy-6-nitrotoluene); |
| Molecular Structure: |
 |
if you are sourcing 2-Hydroxy-6-nitrotoluene from United-States ,just feel free to inquire