Details for 2-Methoxy-p-cresol

2-Methoxy-p-cresol
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
93-51-6 |
| EC NO: |
202-252-9 |
| Molecular Formula: |
C8H10O2 |
| Molecular Weight: |
138.1638 |
| Specification: |
|
| InChI: |
InChI=1/C8H10O2/c1-6-5-7(10-2)3-4-8(6)9/h3-5,9H,1-2H3 |
| Synonyms: |
1-Hydroxy-2-methoxy-4-methylbenzene;202-252-9;2-Methoxy-4-methylphenol;2-methoxy-p-cresol;3-Methoxy-4-hydroxytoluene;4-Hydroxy-3-methoxy-1-methylbenzene;4-Hydroxy-3-methoxytoluene;4-Methyl guaiacol;4-Methyl-2-methoxyphenol;4-methoxy-2-methylphenol; |
| Molecular Structure: |
 |
if you are sourcing 2-Methoxy-p-cresol from United-States ,just feel free to inquire