Details for 3-Methyl-2-phenylbutyronitrile

3-Methyl-2-phenylbutyronitrile
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
5558-29-2 |
| EC NO: |
|
| Molecular Formula: |
C11H13N |
| Molecular Weight: |
159.2276 |
| Specification: |
|
| InChI: |
InChI=1/C11H13N/c1-9(2)11(8-12)10-6-4-3-5-7-10/h3-7,9,11H,1-2H3/t11-/m1/s1 |
| Synonyms: |
a-(iso-Propyl)phenylacetonitrile;3-methyl-2-phenylbutanenitrile;(2S)-3-methyl-2-phenylbutanenitrile;(2R)-3-methyl-2-phenylbutanenitrile; |
| Molecular Structure: |
 |
if you are sourcing 3-Methyl-2-phenylbutyronitrile from United-States ,just feel free to inquire