Details for 3-Phenyl-1(3H)-isobenzofuranone

3-Phenyl-1(3H)-isobenzofuranone
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
5398-11-8 |
| EC NO: |
226-426-9 |
| Molecular Formula: |
C14H10O2 |
| Molecular Weight: |
210.228 |
| Specification: |
|
| InChI: |
InChI=1/C14H10O2/c15-14-12-9-5-4-8-11(12)13(16-14)10-6-2-1-3-7-10/h1-9,13H/t13-/m1/s1 |
| Synonyms: |
3-Phenylphthalide;3-phenyl-2-benzofuran-1(3H)-one;(3S)-3-phenyl-2-benzofuran-1(3H)-one;(3R)-3-phenyl-2-benzofuran-1(3H)-one; |
| Molecular Structure: |
 |
if you are sourcing 3-Phenyl-1(3H)-isobenzofuranone from United-States ,just feel free to inquire