Details for 5-Methyl-4-nitroso-2-iso-propylphenol

5-Methyl-4-nitroso-2-iso-propylphenol
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
2364-54-7 |
| EC NO: |
|
| Molecular Formula: |
C10H13NO2 |
| Molecular Weight: |
179.2157 |
| Specification: |
|
| InChI: |
InChI=1/C10H13NO2/c1-6(2)8-5-9(11-13)7(3)4-10(8)12/h4-6,12H,1-3H3 |
| Synonyms: |
p-Nitrosothymol;5-methyl-4-nitroso-2-(propan-2-yl)phenol;5-Methyl-4-nitroso-2-isopropylphenol; |
| Molecular Structure: |
 |
if you are sourcing 5-Methyl-4-nitroso-2-iso-propylphenol from United-States ,just feel free to inquire