Details for N-Phenyl-2,6-dichloroaniline

N-Phenyl-2,6-dichloroaniline
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
15307-93-4 |
| EC NO: |
239-349-0 |
| Molecular Formula: |
C12H9Cl2N |
| Molecular Weight: |
238.1126 |
| Specification: |
|
| InChI: |
InChI=1/C12H9Cl2N/c13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h1-8,15H |
| Synonyms: |
N-Phenyl-2,6-dichloroaniline;2,6-dichloro diphenylamine;2,6-dichloro-N-phenylaniline; |
| Molecular Structure: |
 |
if you are sourcing N-Phenyl-2,6-dichloroaniline from United-States ,just feel free to inquire