Details for N-Phthalyl-DL-glutamic Anhydride

N-Phthalyl-DL-glutamic Anhydride
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
3085-92-5 |
| EC NO: |
222-088-1 |
| Molecular Formula: |
C13H9NO5 |
| Molecular Weight: |
259.2143 |
| Specification: |
|
| InChI: |
InChI=1/C13H9NO5/c15-10-6-5-9(13(18)19-10)14-11(16)7-3-1-2-4-8(7)12(14)17/h1-4,9H,5-6H2 |
| Synonyms: |
2-(2,6-dioxotetrahydro-2H-pyran-3-yl)-1H-isoindole-1,3(2H)-dione; |
| Molecular Structure: |
 |
if you are sourcing N-Phthalyl-DL-glutamic Anhydride from United-States ,just feel free to inquire