Details for p-Nitrophenyl Dodecyl Ether

p-Nitrophenyl Dodecyl Ether
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
65039-18-1 |
| EC NO: |
|
| Molecular Formula: |
C18H29NO3 |
| Molecular Weight: |
307.4278 |
| Specification: |
|
| InChI: |
InChI=1/C18H29NO3/c1-2-3-4-5-6-7-8-9-10-11-16-22-18-14-12-17(13-15-18)19(20)21/h12-15H,2-11,16H2,1H3 |
| Synonyms: |
4-n-Dodecyloxynitrobenzene;p-Nitrophenyl Dodecyl Ether;1-(dodecyloxy)-4-nitrobenzene; |
| Molecular Structure: |
 |
if you are sourcing p-Nitrophenyl Dodecyl Ether from United-States ,just feel free to inquire