Details for p-Pentyloxybenzylidene p-Heptylaniline

p-Pentyloxybenzylidene p-Heptylaniline
| Category: |
|
|
| CAS NO: |
39777-20-3 |
| EC NO: |
|
| Molecular Formula: |
C25H35NO |
| Molecular Weight: |
365.5515 |
| Specification: |
|
| InChI: |
InChI=1/C25H35NO/c1-3-5-7-8-9-11-22-12-16-24(17-13-22)26-21-23-14-18-25(19-15-23)27-20-10-6-4-2/h12-19,21H,3-11,20H2,1-2H3/b26-21+ |
| Synonyms: |
p-Pentyloxybenzylidene-p-heptylaniline;4-heptyl-N-{(E)-[4-(pentyloxy)phenyl]methylidene}aniline; |
| Molecular Structure: |
 |
if you are sourcing p-Pentyloxybenzylidene p-Heptylaniline from United-States ,just feel free to inquire