Details for 2-Bromobenzaldehyde

2-Bromobenzaldehyde
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
6630-33-7 |
| EC NO: |
229-622-2 |
| Molecular Formula: |
C17H15NO4S2 |
| Molecular Weight: |
361.4353 |
| Specification: |
|
| InChI: |
InChI=1/C17H15NO4S2/c1-20-12-5-6-14(21-2)11(8-12)9-15-16(19)18(17(23)24-15)10-13-4-3-7-22-13/h3-9H,10H2,1-2H3/b15-9+ |
| Synonyms: |
o-Bromobenzaldehyde;2-Bromo Benzaldehyde;(5E)-5-(2,5-dimethoxybenzylidene)-3-(furan-2-ylmethyl)-2-thioxo-1,3-thiazolidin-4-one; |
| Molecular Structure: |
 |
if you are sourcing 2-Bromobenzaldehyde from United-States ,just feel free to inquire