| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
123-54-6 |
| EC NO: |
204-634-0 |
| Molecular Formula: |
C5H8O2 |
| Molecular Weight: |
100.1158 |
| Specification: |
|
| InChI: |
InChI=1/C5H8O2/c1-4(6)3-5(2)7/h3,6H,1-2H3/b4-3- |
Product description:
A respiratory protection program that meets OSHA's 29 CFR 1910.134 and ANSI Z88.2 requirements or European Standard EN 149 must be followed whenever workplace conditions warrant a respirator's use.
|
| Synonyms: |
Acetylacetone;pentane-2,4-dione;pentane-2,3-dione;(3E)-4-hydroxypent-3-en-2-one;(3Z)-4-hydroxypent-3-en-2-one;Acetyl Acetone;2,4-Pentane dione;2,4-Pentandione; |
| Molecular Structure: |
 |