Details for Ethyl phenylphosphinate

Ethyl phenylphosphinate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2511-09-3 |
EC NO: |
|
Molecular Formula: |
C8H11O2P |
Molecular Weight: |
170.1455 |
Specification: |
|
InChI: |
InChI=1/C8H11O2P/c1-2-10-11(9)8-6-4-3-5-7-8/h3-7,11H,2H2,1H3 |
Synonyms: |
Phosphinic acid, phenyl-, ethyl ester;Ethyl phenylphosphinate;NSC 300841;O-Ethyl phenylphosphinate;Phenylphosphinic acid ethyl ester;ethoxy(oxo)phenylphosphonium;O-Ethyl phenylphosphoinate; |
Molecular Structure: |
 |
if you are sourcing Ethyl phenylphosphinate from United-States ,just feel free to inquire