Details for 4-Chloro-3-nitrobenzoic acid

4-Chloro-3-nitrobenzoic acid
Category: |
Catalyst and Auxiliary |
|
CAS NO: |
96-99-1 |
EC NO: |
202-550-9 |
Molecular Formula: |
C7H4ClNO4 |
Molecular Weight: |
201.57 |
Specification: |
|
InChI: |
InChI=1/C7H4ClNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11)/p-1 |
Synonyms: |
4-Chloro-3-Nitobenzoic Acid;3-Nitro-4-Chloro Benzoic Acid;4-chloro-3-nitro benzoic acid;4-chloro-3-nitrobenzoate;CHLORO(4-)-3-NITROBENZOIC ACID;BENZOIC ACID, 4-CHLORO-3-NITRO-;LABOTEST-BB LT00013440;RARECHEM AL BO 0284;TIMTEC-BB SBB000404;4-chloro-3-nitro-benzoicacid; |
Molecular Structure: |
 |
if you are sourcing 4-Chloro-3-nitrobenzoic acid from United-States ,just feel free to inquire