Details for CETYL ALCOHOL

CETYL ALCOHOL
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
8005-44-5 |
| EC NO: |
267-008-6 |
| Molecular Formula: |
C34H70O |
| Molecular Weight: |
494.919 |
| Specification: |
|
| InChI: |
InChI=1/C34H70O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-34(35)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h34-35H,3-33H2,1-2H3 |
| Synonyms: |
Ceto-stearyl alcohol;Cetearyl alcohol;CETYL-STEARYL ALCOHOL;C1618;heptadecan-1-ol;hexadecan-1-ol - octadecan-1-ol (1:1);tetratriacontan-17-ol; |
| Molecular Structure: |
 |
if you are sourcing CETYL ALCOHOL from United-States ,just feel free to inquire