Details for 4-Hydroxyphenylboronic acid THP ether

4-Hydroxyphenylboronic acid THP ether
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
182281-01-2 |
| EC NO: |
|
| Molecular Formula: |
C11H15BO4 |
| Molecular Weight: |
222.0454 |
| Specification: |
|
| InChI: |
InChI=1/C11H15BO4/c13-12(14)9-4-6-10(7-5-9)16-11-3-1-2-8-15-11/h4-7,11,13-14H,1-3,8H2 |
| Synonyms: |
[4-[tetrahydro-2H-Pyran-2-yl)oxy]phenyl]-boronic acid;4-(2-Tetrahydropyranyloxy)phenylboronic acid;4-(tetrahydro-2H-pyran-2-yloxy)phenylboronic acid;[4-(Tetrahydro-2H-pyran-2-yloxy)phenyl]boronic acid; |
| Molecular Structure: |
 |
if you are sourcing 4-Hydroxyphenylboronic acid THP ether from United-States ,just feel free to inquire