Details for 4-Isopropoxyphenylboronic acid

4-Isopropoxyphenylboronic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
153624-46-5 |
| EC NO: |
|
| Molecular Formula: |
C9H13BO3 |
| Molecular Weight: |
180.0087 |
| Specification: |
|
| InChI: |
InChI=1/C9H13BO3/c1-7(2)13-9-5-3-8(4-6-9)10(11)12/h3-7,11-12H,1-2H3 |
| Synonyms: |
4-Isopropoxyphenylboronic ACID;4-ISOPROPOXYBENZENEBORONIC isopropoxybenzeneboronic acid;AKOS BRN-0675;CHEMBRDG-BB 4009733;P-Isopropoxyphenylboronic ACID;4-Isopropoxyphebylboronic acid;4-Isopropoxyphenylboronic;[4-(1-methylethoxy)phenyl]boronic acid;4-iso-Propoxyphenylboronic acid;4-Isopropoxybenzeneboronic Acid; |
| Molecular Structure: |
 |
if you are sourcing 4-Isopropoxyphenylboronic acid from United-States ,just feel free to inquire