Details for 2-PYRROLYL METHYL KETONE

2-PYRROLYL METHYL KETONE
| Category: |
Organic chemicals and Derivatives/Heterocyclic compounds |
|
| CAS NO: |
1072-83-9 |
| EC NO: |
214-016-2 |
| Molecular Formula: |
C6H7NO |
| Molecular Weight: |
109.1259 |
| Specification: |
|
| InChI: |
InChI=1/C6H7NO/c1-5(8)6-3-2-4-7-6/h2-4,7H,1H3 |
| Synonyms: |
2-Acetopyrrole;2-Pyrrolyl methyl ketone;Ethanone, 1-(1H-pyrrol-2-yl)-;Methyl 2-pyrrolyl ketone;1-(1H-pyrrol-2-yl)ethanone;2-Acetyl Pyrrole; |
| Molecular Structure: |
 |
if you are sourcing 2-PYRROLYL METHYL KETONE from United-States ,just feel free to inquire