Details for Acetyl Butyryl

Acetyl Butyryl
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
3848-24-6 |
| EC NO: |
223-350-8 |
| Molecular Formula: |
C6H10O2 |
| Molecular Weight: |
114.1424 |
| Specification: |
|
| InChI: |
InChI=1/C6H10O2/c1-3-4-6(8)5(2)7/h3-4H2,1-2H3 |
| Synonyms: |
2,3-Hexanedione;AI3-35989;Acetyl butyryl;Acetylbutyryl;BRN 1699896;Butyryl acetyl;FEMA No. 2558;Methyl propyl diketone;NSC 31665;hexane-2,3-dione; |
| Molecular Structure: |
 |
if you are sourcing Acetyl Butyryl from United-States ,just feel free to inquire