Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
56-89-3 |
EC NO: |
200-296-3 |
Molecular Formula: |
C3H7NO2S3 |
Molecular Weight: |
185.28818 |
Specification: |
|
InChI: |
InChI=1/C3H6NO2S3/c5-3(6)2(4-7)1-9-8/h2H,1,4H2,(H,5,6) |
Product description:
White powder. A covalently linked dimeric nonessential amino acid formed by the oxidation of CYSTEINE. Two molecules of cysteine are joined together by a disulfide bridge to form cystine.
|
Synonyms: |
L(-)-3,3-Dithiobis(2-aminopropanoic acid);L-Cystine, synthetically derived;(H-Cys-OH)2 (Disulfide bond);(H-Cys-OH)2;H-(Cys)_2-OH;(-)-3,3-Dithiobis(2-aminopropionic acid);2-Amino-3-[(2-amino-2-carboxyethyl)dithio]propanoic acid;L-Cystine,food grade;Cystine;(2R,2'S)-3,3'-disulfanediylbis(2-ammoniopropanoate);Dicysteine; |
Molecular Structure: |
 |