| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
76963-41-2 |
| EC NO: |
|
| Molecular Formula: |
C12H21N5O2S2 |
| Molecular Weight: |
331.4574 |
| Specification: |
|
| InChI: |
InChI=1/C12H21N5O2S2/c1-13-11(6-17(18)19)14-4-5-20-8-10-9-21-12(15-10)7-16(2)3/h6,9,13-14H,4-5,7-8H2,1-3H3/b11-6+ |
| Synonyms: |
n-(2-(((2-((dimethylamino)methyl)-4-thiazolyl)methyl)thio)ethyl)-n'-methyl-2-nitro-1,1-ethenediamine;N-{2-[({2-[(dimethylamino)methyl]-1,3-thiazol-4-yl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine;(E)-N-{2-[({2-[(dimethylamino)methyl]-1,3-thiazol-4-yl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine; |
| Molecular Structure: |
 |