Details for Butyl Acrylate

Butyl Acrylate
| Category: |
Paint and Coatings |
|
| CAS NO: |
141-32-2 |
| EC NO: |
205-480-7 |
| Molecular Formula: |
C7H12O2 |
| Molecular Weight: |
128.1616 |
| Specification: |
|
| InChI: |
InChI=1/C7H12O2/c1-3-4-5-6(2)7(8)9/h2-5H2,1H3,(H,8,9)/p-1 |
| Synonyms: |
2-Propenoic acid butyl ester;Butyl 2-Propenoate;n-Butyl Acrylate;Propenoic acid n-butyl ester;butyl prop-2-enoate;2-methylidenehexanoate;BA;Butylacrylate,inhibited;acrylatedebutyle;1-butylacrylate; |
| Molecular Structure: |
 |
if you are sourcing Butyl Acrylate from United-States ,just feel free to inquire