Details for Methyl 4-Hydroxyphenylacetate

Methyl 4-Hydroxyphenylacetate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
14199-15-6 |
EC NO: |
238-050-2 |
Molecular Formula: |
C9H10O3 |
Molecular Weight: |
166.1739 |
Specification: |
|
InChI: |
InChI=1/C9H10O3/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5,10H,6H2,1H3 |
Synonyms: |
Acetic acid, (p-hydroxyphenyl)-, methyl ester;Benzeneacetic acid, 4-hydroxy-, methyl ester;Methyl (4-hydroxyphenyl)acetate;HPME;4-Hydroxyphenylacetic acid methl ester; |
Molecular Structure: |
 |
if you are sourcing Methyl 4-Hydroxyphenylacetate from United-States ,just feel free to inquire