| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
143-07-7 |
| EC NO: |
205-582-1 |
| Molecular Formula: |
C12H24O2 |
| Molecular Weight: |
200.3178 |
| Specification: |
NATURAL |
| InChI: |
InChI=1/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
Product description:
White, colorless or slightly yellow crystalline solid or powder with a slight, but characteristic odor, like oil of bay.
|
| Synonyms: |
Dodecanoic acid;lauric acid free acid sigma grade;lauric acid, pure;Lauric acid 98-101 % (acidimetric);Lauric Acid (Dodecanoic acid,C12); |
| Molecular Structure: |
 |