Details for Pigment Red 3

Pigment Red 3
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
2425-85-6 |
| EC NO: |
219-372-2 |
| Molecular Formula: |
C17H13N3O3 |
| Molecular Weight: |
307.3034 |
| Specification: |
|
| InChI: |
InChI=1/C17H13N3O3/c1-11-6-8-14(15(10-11)20(22)23)18-19-17-13-5-3-2-4-12(13)7-9-16(17)21/h2-10,18H,1H3/b19-17- |
| Synonyms: |
C.I. 12120;C.I. Pigment Red 3;1-(4-Methyl-2-nitrophenylazo)-2-naphthol;Pigment Red 3;1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one;(1Z)-1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one; |
| Molecular Structure: |
 |
if you are sourcing Pigment Red 3 from United-States ,just feel free to inquire