Details for Solvent Red 24

Solvent Red 24
| Category: |
Agrochemicals |
|
| CAS NO: |
85-83-6 |
| EC NO: |
201-635-8 |
| Molecular Formula: |
C24H20N4O |
| Molecular Weight: |
380.4418 |
| Specification: |
|
| InChI: |
InChI=1/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3/b26-25+,28-27+ |
| Synonyms: |
C.I. 26105;C.I. 258;C.I. Solvent Red 24;C.I. Solvent Red 24 (8CI);Scarlet red [NF X];1-[2-Methyl-4-(2-methylphenylazo)phenylazo]-2-naphthol;Lipid crimson;Scarlet Red;Solvent Red 24;scarlet R;1-(2-methyl-4-(2-methylphenylazo)phenylazo)-2-naphthol;1-((2-Methyl-4-((2-methylphenyl)azo)phenyl)azo)-2-naphthalenol;1-((4-(o-tolylazo)-o-tolyl)azo)-2-naphtho;1-((E)-(2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl)diazenyl)-2-naphth;1-(4-(o-Tolylazo)-o-tolylazo)-2-naphthol;1-(4-o-tolylazo-o-tolylazo)-2-naphthol;1-[[2-methyl-4-[(2-methylphenyl)azo]phenyl]azo]-2-naphthaleno;2',3-Dimethyl-4-(2-hydroxynaphthylazo)azobenzene;(1Z)-1-({2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one;1-({2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one;1-[(E)-{2-methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}diazenyl]naphthalen-2-ol; Solvent Red 24; |
| Molecular Structure: |
 |
if you are sourcing Solvent Red 24 from United-States ,just feel free to inquire