Details for BUTYL OLEATE

BUTYL OLEATE
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
142-77-8 |
| EC NO: |
205-559-6 |
| Molecular Formula: |
C22H42O2 |
| Molecular Weight: |
338.5677 |
| Specification: |
|
| InChI: |
InChI=1/C22H42O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2/h12-13H,3-11,14-21H2,1-2H3/b13-12- |
Product description:
Clear liquid with a faty odor.
|
| Synonyms: |
9-Octadecenoic acid (Z)-, butyl ester;Butyl oleate;OLEIC ACID N-BUTYL ESTER;(Z)-9-Octadecenoic acid butyl ester;
;butyl (9Z)-octadec-9-enoate; |
| Molecular Structure: |
 |
if you are sourcing BUTYL OLEATE from United-States ,just feel free to inquire