Details for Dipropylene Glycol Monomethyl Ether

 
Dipropylene Glycol Monomethyl Ether
 
      
        | Category: | 
        Organic chemicals and Derivatives | 
        
        	 | 
      
      
        | CAS NO: | 
      34590-94-8   | 
      
      
        | EC NO: | 
        
        252-104-2 | 
      
      
        | Molecular Formula: | 
        
        C7H16O3 | 
      
					
					  | Molecular Weight: | 
                      148.2001 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      Di(propylene glycol) methyl ether;Methoxypropoxypropanol;Dipropylene glycol monomethyl ether;DPM; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  Dipropylene Glycol Monomethyl Ether from  United-States ,just feel free to inquire