Details for Methyl Red Sodium Salt

Methyl Red Sodium Salt
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
845-10-3 |
| EC NO: |
212-682-9 |
| Molecular Formula: |
C15H14N3O2 |
| Molecular Weight: |
268.2911 |
| Specification: |
|
| InChI: |
InChI=1/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20)/p-1/b17-16+ |
| Synonyms: |
2-[4-(Dimethylamino)phenylazo]benzoic acid, sodium salt;C.I. 13020~Methyl Red, sodium salt;methyl red sodium crystalline;sodium 2-(p-(dimethylamino)phenylazo)benzoate;Methyl Red, water soluble;sodium 2-{(E)-[4-(dimethylamino)phenyl]diazenyl}benzoate;2-{(E)-[4-(dimethylamino)phenyl]diazenyl}benzoate; |
| Molecular Structure: |
 |
if you are sourcing Methyl Red Sodium Salt from United-States ,just feel free to inquire